CAS 898771-40-9

(3-fluorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone

Description:

(3-fluorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898771-40-9, is an organic compound characterized by its complex structure, which includes a fluorinated phenyl group and a piperidylmethyl substituent. The presence of the fluorine atom enhances its lipophilicity and may influence its biological activity, making it a subject of interest in medicinal chemistry. The compound features a ketone functional group, which is indicative of its potential reactivity and interactions in various chemical environments. Its piperidine ring contributes to its pharmacological properties, often associated with central nervous system activity. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the realm of pharmaceutical chemistry.

Formula: C₁₉H₂₀FNO

InChI: InChI=1/C19H20FNO/c20-18-6-4-5-17(13-18)19(22)16-9-7-15(8-10-16)14-21-11-2-1-3-12-21/h4-10,13H,1-3,11-12,14H2

SMILES: C1CCN(CC1)Cc1ccc(cc1)C(=O)c1cccc(c1)F