CymitQuimica logo

CAS 898771-41-0

:

(2-Chloro-4-fluorophenyl)-3-thienylmethanone

Description:
(2-Chloro-4-fluorophenyl)-3-thienylmethanone, identified by its CAS number 898771-41-0, is an organic compound characterized by its unique molecular structure, which includes a thienyl group and a substituted phenyl ring. The presence of chlorine and fluorine atoms on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its thienyl moiety may impart specific electronic properties, influencing its interactions in chemical reactions or biological systems. The compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to the presence of halogen substituents that can enhance lipophilicity and bioactivity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, (2-Chloro-4-fluorophenyl)-3-thienylmethanone represents a valuable compound for further exploration in various chemical and biological applications.
Formula:C11H6ClFOS
InChI:InChI=1S/C11H6ClFOS/c12-10-5-8(13)1-2-9(10)11(14)7-3-4-15-6-7/h1-6H
InChI key:InChIKey=RUVOXBMRINTMAL-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(F)C=C1)C=2C=CSC2
Synonyms:
  • Methanone, (2-chloro-4-fluorophenyl)-3-thienyl-
  • (2-Chloro-4-fluorophenyl)-3-thienylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.