CAS 898771-43-2

(4-fluorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone

Description:

(4-fluorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898771-43-2, is a synthetic organic compound characterized by its complex structure that includes a fluorinated phenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic characteristics. The piperidine ring may impart basic properties, allowing for potential interactions with various receptors or enzymes. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. However, specific details regarding its reactivity, stability, and biological activity would require empirical data from experimental studies. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₉H₂₀FNO

InChI: InChI=1/C19H20FNO/c20-18-10-8-17(9-11-18)19(22)16-6-4-15(5-7-16)14-21-12-2-1-3-13-21/h4-11H,1-3,12-14H2

SMILES: C1CCN(CC1)Cc1ccc(cc1)C(=O)c1ccc(cc1)F