CymitQuimica logo

CAS 898771-44-3

:

(3-chloro-5-fluoro-phenyl)-(3-thienyl)methanone

Description:
(3-chloro-5-fluoro-phenyl)-(3-thienyl)methanone, identified by its CAS number 898771-44-3, is a chemical compound characterized by its unique structure that includes a phenyl ring substituted with chlorine and fluorine atoms, as well as a thienyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may include moderate to high stability under standard conditions. The presence of halogen substituents can influence its reactivity, making it potentially useful in various chemical reactions, including electrophilic aromatic substitution. Additionally, the thienyl moiety may impart specific electronic properties, enhancing its potential applications in pharmaceuticals or agrochemicals. The compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the nature of the substituents. Overall, (3-chloro-5-fluoro-phenyl)-(3-thienyl)methanone is of interest in synthetic organic chemistry and may serve as a building block for more complex molecules.
Formula:C11H6ClFOS
InChI:InChI=1/C11H6ClFOS/c12-9-3-8(4-10(13)5-9)11(14)7-1-2-15-6-7/h1-6H
SMILES:c1cscc1C(=O)c1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.