CAS 898771-47-6
:(4-chloro-2-fluoro-phenyl)-(3-thienyl)methanone
Description:
(4-chloro-2-fluoro-phenyl)-(3-thienyl)methanone is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a thienyl group. The presence of these halogen substituents can influence the compound's reactivity, polarity, and overall chemical behavior. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic characteristics and may enhance its electronic properties. This compound is likely to exhibit moderate to high lipophilicity due to the presence of aromatic rings, which can affect its solubility in organic solvents. Additionally, the functional group methanone indicates the presence of a carbonyl group, which can participate in various chemical reactions, such as nucleophilic addition or condensation. Overall, the combination of these features suggests that (4-chloro-2-fluoro-phenyl)-(3-thienyl)methanone may have potential applications in pharmaceuticals or materials science, particularly in the development of novel compounds with specific biological or chemical properties.
Formula:C11H6ClFOS
InChI:InChI=1/C11H6ClFOS/c12-8-1-2-9(10(13)5-8)11(14)7-3-4-15-6-7/h1-6H
SMILES:c1cc(c(cc1Cl)F)C(=O)c1ccsc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.