CAS 898771-48-7

Ethyl 3-[3-(1-azetidinylmethyl)benzoyl]benzoate

Description:

Ethyl 3-[3-(1-azetidinylmethyl)benzoyl]benzoate, identified by its CAS number 898771-48-7, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group and a benzoyl moiety. This compound features an azetidine ring, contributing to its potential biological activity and pharmacological properties. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity due to the presence of aromatic rings, which can influence their solubility and permeability in biological systems. The presence of the azetidine ring may also suggest potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's structure may allow for various functionalization, which can be explored for further chemical modifications or applications in drug development. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other reagents or catalysts.

Formula: C₂₀H₂₁NO₃

InChI: InChI=1S/C20H21NO3/c1-2-24-20(23)18-9-4-8-17(13-18)19(22)16-7-3-6-15(12-16)14-21-10-5-11-21/h3-4,6-9,12-13H,2,5,10-11,14H2,1H3

InChI key: InChIKey=RQIZJQCZGFPFPH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C(OCC)=O)=CC=C1)C2=CC(CN3CCC3)=CC=C2

Synonyms:

• Benzoic acid, 3-[3-(1-azetidinylmethyl)benzoyl]-, ethyl ester
• Ethyl 3-[3-(1-azetidinylmethyl)benzoyl]benzoate