CymitQuimica logo

CAS 898771-49-8

:

(2,4-dimethylphenyl)-[4-(1-piperidylmethyl)phenyl]methanone

Description:
The chemical substance known as (2,4-dimethylphenyl)-[4-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898771-49-8, is a synthetic organic compound that belongs to the class of ketones. It features a complex structure characterized by a central carbonyl group (C=O) flanked by two distinct aromatic rings, one of which contains a piperidine moiety. This compound exhibits properties typical of ketones, such as being a solid or liquid at room temperature, depending on its specific formulation and purity. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the piperidine ring, which is often associated with biological activity. Additionally, the presence of multiple methyl groups on the aromatic ring may influence its lipophilicity and overall reactivity. As with many organic compounds, safety and handling precautions are essential, as it may pose risks such as irritation or toxicity. Further studies would be necessary to fully elucidate its biological properties and potential applications.
Formula:C21H25NO
InChI:InChI=1/C21H25NO/c1-16-6-11-20(17(2)14-16)21(23)19-9-7-18(8-10-19)15-22-12-4-3-5-13-22/h6-11,14H,3-5,12-13,15H2,1-2H3
SMILES:Cc1ccc(c(C)c1)C(=O)c1ccc(cc1)CN1CCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.