CAS 898771-53-4

Methanone, [3-(1-azetidinylmethyl)phenyl][2-(methylthio)phenyl]-

Description:

Methanone, [3-(1-azetidinylmethyl)phenyl][2-(methylthio)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and various substituents that contribute to its properties. The presence of the azetidine ring indicates that it has a cyclic amine structure, which can influence its reactivity and biological activity. The methylthio group attached to the phenyl ring suggests potential for increased lipophilicity, which may affect its solubility and interaction with biological membranes. This compound may exhibit unique pharmacological properties due to its specific molecular configuration, making it of interest in medicinal chemistry. Additionally, the presence of multiple aromatic rings can contribute to its stability and potential for π-π stacking interactions. Overall, the characteristics of this compound, including its molecular weight, solubility, and reactivity, would be essential for understanding its applications in research and potential therapeutic uses.

Formula: C₁₈H₁₉NOS

InChI: InChI=1/C18H19NOS/c1-21-17-9-3-2-8-16(17)18(20)15-7-4-6-14(12-15)13-19-10-5-11-19/h2-4,6-9,12H,5,10-11,13H2,1H3

InChI key: InChIKey=UBTHTRCPKNXYSZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SC)C=CC=C1)C2=CC(CN3CCC3)=CC=C2

Synonyms:

• [3-(1-Azetidinylmethyl)phenyl][2-(methylsulfanyl)phenyl]methanone
• Methanone, [3-(1-azetidinylmethyl)phenyl][2-(methylthio)phenyl]-