CAS 898771-55-6
:Methanone, [3-(1-azetidinylmethyl)phenyl][4-(methylthio)phenyl]-
Description:
Methanone, [3-(1-azetidinylmethyl)phenyl][4-(methylthio)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the azetidine moiety suggests that it may exhibit unique biological properties, potentially influencing its reactivity and interaction with biological systems. The methylthio group attached to one of the phenyl rings can enhance the compound's lipophilicity, affecting its solubility and permeability. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its molecular structure indicates that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the presence of electron-donating and electron-withdrawing groups. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which it is studied. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C18H19NOS
InChI:InChI=1S/C18H19NOS/c1-21-17-8-6-15(7-9-17)18(20)16-5-2-4-14(12-16)13-19-10-3-11-19/h2,4-9,12H,3,10-11,13H2,1H3
InChI key:InChIKey=QOHKFSYIDJUCLV-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=CC=C(SC)C=C3
Synonyms:- [3-(1-Azetidinylmethyl)phenyl][4-(methylsulfanyl)phenyl]methanone
- Methanone, [3-(1-azetidinylmethyl)phenyl][4-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.