CAS 898771-58-9
:(3,5-dichlorophenyl)-(3-thienyl)methanone
Description:
(3,5-Dichlorophenyl)-(3-thienyl)methanone is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with two chlorine atoms at the 3 and 5 positions, and a thienyl group attached to a carbonyl (ketone) functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The dichlorophenyl moiety contributes to its electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. The thienyl group, being a five-membered aromatic ring containing sulfur, may impart additional characteristics such as increased solubility in organic solvents and unique interactions in biological systems. The compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.
Formula:C11H6Cl2OS
InChI:InChI=1/C11H6Cl2OS/c12-9-3-8(4-10(13)5-9)11(14)7-1-2-15-6-7/h1-6H
SMILES:c1cscc1C(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.