CymitQuimica logo

CAS 898771-61-4

:

Methanone, [3-(1-azetidinylmethyl)phenyl](3-chlorophenyl)-

Description:
Methanone, [3-(1-azetidinylmethyl)phenyl](3-chlorophenyl)-, also known by its CAS number 898771-61-4, is an organic compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with a chlorophenyl group. The presence of the azetidine moiety introduces a cyclic amine structure, which can influence the compound's reactivity and biological activity. This compound may exhibit properties typical of ketones, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. Its chlorophenyl substitution can enhance lipophilicity and potentially affect its pharmacokinetic properties. The specific arrangement of functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies would be necessary to fully understand its biological activity, toxicity, and potential uses in various chemical applications. As with many organic compounds, safety precautions should be taken when handling this substance due to potential health risks associated with its chemical structure.
Formula:C17H16ClNO
InChI:InChI=1S/C17H16ClNO/c18-16-7-2-6-15(11-16)17(20)14-5-1-4-13(10-14)12-19-8-3-9-19/h1-2,4-7,10-11H,3,8-9,12H2
InChI key:InChIKey=MXWUAKMNZYLRAH-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=CC(Cl)=CC=C3
Synonyms:
  • Methanone, [3-(1-azetidinylmethyl)phenyl](3-chlorophenyl)-
  • [3-(1-Azetidinylmethyl)phenyl](3-chlorophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.