CAS 898771-62-5
:(3,4-difluorophenyl)-(3-thienyl)methanone
Description:
(3,4-Difluorophenyl)-(3-thienyl)methanone is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with two fluorine atoms and a thienyl group. The presence of the fluorine atoms enhances the compound's lipophilicity and can influence its reactivity and biological activity. The thienyl moiety, derived from thiophene, contributes to the compound's aromaticity and can participate in various chemical reactions. This compound may exhibit interesting properties such as potential biological activity, making it of interest in medicinal chemistry and material science. Its molecular structure suggests it could be involved in interactions with biological targets, possibly serving as a lead compound in drug development. Additionally, the presence of both fluorine and sulfur in its structure may impart unique electronic properties, affecting its stability and reactivity. Overall, (3,4-difluorophenyl)-(3-thienyl)methanone represents a class of compounds that can be explored for various applications in pharmaceuticals and organic synthesis.
Formula:C11H6F2OS
InChI:InChI=1/C11H6F2OS/c12-9-2-1-7(5-10(9)13)11(14)8-3-4-15-6-8/h1-6H
InChI key:InChIKey=QATLINARFDBPGR-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(=O)c1ccsc1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.