CAS 898771-63-6

Methanone, [3-(1-azetidinylmethyl)phenyl](4-chlorophenyl)-

Description:

Methanone, [3-(1-azetidinylmethyl)phenyl](4-chlorophenyl)-, also known by its CAS number 898771-63-6, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with a chlorophenyl group. The presence of the azetidine moiety introduces a cyclic amine structure, which can influence the compound's biological activity and pharmacological properties. This compound is likely to exhibit specific reactivity due to the electrophilic nature of the carbonyl group in the methanone, making it a potential candidate for various chemical reactions, including nucleophilic attacks. Additionally, the chlorophenyl group may enhance lipophilicity, affecting the compound's solubility and permeability in biological systems. Such structural features suggest that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties, including its stability, reactivity, and potential applications.

Formula: C₁₇H₁₆ClNO

InChI: InChI=1S/C17H16ClNO/c18-16-7-5-14(6-8-16)17(20)15-4-1-3-13(11-15)12-19-9-2-10-19/h1,3-8,11H,2,9-10,12H2

InChI key: InChIKey=HYHADGBZJUSQTM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=CC=C(Cl)C=C3

Synonyms:

• [3-(1-Azetidinylmethyl)phenyl](4-chlorophenyl)methanone
• Methanone, [3-(1-azetidinylmethyl)phenyl](4-chlorophenyl)-