CAS 898771-64-7
:(3,5-difluorophenyl)-(3-thienyl)methanone
Description:
(3,5-Difluorophenyl)-(3-thienyl)methanone is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with two fluorine atoms at the 3 and 5 positions, and a thienyl group attached to a carbonyl (ketone) functional group. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, including potential reactivity due to the presence of the carbonyl group. The fluorine substituents can influence the electronic properties of the molecule, potentially enhancing its lipophilicity and altering its reactivity compared to non-fluorinated analogs. The thienyl group, being a five-membered aromatic ring containing sulfur, may contribute to the compound's overall stability and reactivity. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in various applications. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H6F2OS
InChI:InChI=1/C11H6F2OS/c12-9-3-8(4-10(13)5-9)11(14)7-1-2-15-6-7/h1-6H
InChI key:InChIKey=OMKYDXNLQORNPE-UHFFFAOYSA-N
SMILES:c1cscc1C(=O)c1cc(cc(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.