CAS 898771-65-8
:Methanone, [3-(1-azetidinylmethyl)phenyl](3-fluorophenyl)-
Description:
Methanone, [3-(1-azetidinylmethyl)phenyl](3-fluorophenyl)-, also known by its CAS number 898771-65-8, is a chemical compound that features a ketone functional group, specifically a methanone structure. This compound is characterized by the presence of a phenyl group substituted with a fluorine atom, which can influence its reactivity and biological activity. The azetidine moiety introduces a cyclic amine structure, contributing to the compound's potential pharmacological properties. The presence of both the phenyl and azetidine groups suggests that this compound may exhibit interesting interactions in biological systems, possibly acting as a ligand or a precursor in synthetic pathways. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific properties such as solubility, melting point, and stability would require empirical data for precise characterization. Overall, this compound represents a unique combination of functional groups that may be of interest in various chemical and biological research fields.
Formula:C17H16FNO
InChI:InChI=1S/C17H16FNO/c18-16-7-2-6-15(11-16)17(20)14-5-1-4-13(10-14)12-19-8-3-9-19/h1-2,4-7,10-11H,3,8-9,12H2
InChI key:InChIKey=IUEXOZJPHNETGS-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=CC(F)=CC=C3
Synonyms:- Methanone, [3-(1-azetidinylmethyl)phenyl](3-fluorophenyl)-
- [3-(1-Azetidinylmethyl)phenyl](3-fluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.