CAS 898771-67-0

[3-(azetidin-1-ylmethyl)phenyl]-(4-fluorophenyl)methanone

Description:

[3-(azetidin-1-ylmethyl)phenyl]-(4-fluorophenyl)methanone, identified by its CAS number 898771-67-0, is a synthetic organic compound characterized by its unique structural features. It contains a phenyl ring substituted with a fluorine atom and a ketone functional group, which contributes to its reactivity and potential biological activity. The azetidine moiety, a four-membered nitrogen-containing ring, adds to the compound's complexity and may influence its pharmacological properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals, where it may serve as a lead compound for further modifications aimed at enhancing efficacy or reducing toxicity. The presence of both aromatic and aliphatic components in its structure may also affect its solubility and stability, which are critical factors in the development of therapeutic agents. Overall, this compound represents a fascinating example of modern synthetic chemistry with potential implications in drug discovery.

Formula: C₁₇H₁₆FNO

InChI: InChI=1/C17H16FNO/c18-16-7-5-14(6-8-16)17(20)15-4-1-3-13(11-15)12-19-9-2-10-19/h1,3-8,11H,2,9-10,12H2

SMILES: c1cc(cc(c1)C(=O)c1ccc(cc1)F)CN1CCC1