CAS 898771-68-1
:(2,6-Dichlorophenyl)-3-thienylmethanone
Description:
(2,6-Dichlorophenyl)-3-thienylmethanone, identified by its CAS number 898771-68-1, is an organic compound characterized by its unique structure, which includes a dichlorophenyl group and a thienyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of chlorine substituents on the phenyl ring can influence its electronic properties, making it more reactive in certain chemical reactions. Additionally, the thienyl group, which contains sulfur, can impart distinct characteristics such as increased lipophilicity and potential interactions with biological targets. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a building block for more complex molecules. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used, making it essential to consider these factors in practical applications.
Formula:C11H6Cl2OS
InChI:InChI=1S/C11H6Cl2OS/c12-8-2-1-3-9(13)10(8)11(14)7-4-5-15-6-7/h1-6H
InChI key:InChIKey=LSYGAEQKQMCGSX-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=CC=C1Cl)C=2C=CSC2
Synonyms:- Methanone, (2,6-dichlorophenyl)-3-thienyl-
- (2,6-Dichlorophenyl)-3-thienylmethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.