CAS 898771-69-2

Methanone, [3-(1-azetidinylmethyl)phenyl](2,3-dimethylphenyl)-

Description:

Methanone, [3-(1-azetidinylmethyl)phenyl](2,3-dimethylphenyl)-, with the CAS number 898771-69-2, is a chemical compound that belongs to the class of ketones. It features a methanone functional group, characterized by a carbonyl group (C=O) bonded to two distinct aromatic rings. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing heterocycle, which can influence its biological activity and chemical reactivity. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can interact with biological targets. Its specific properties, such as solubility, melting point, and reactivity, would depend on the arrangement of substituents on the aromatic rings and the azetidine group. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles of such compounds can vary significantly.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-14-6-3-9-18(15(14)2)19(21)17-8-4-7-16(12-17)13-20-10-5-11-20/h3-4,6-9,12H,5,10-11,13H2,1-2H3

InChI key: InChIKey=PHWJTLIRGOXVTE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=C(C)C(C)=CC=C3

Synonyms:

• [3-(1-Azetidinylmethyl)phenyl](2,3-dimethylphenyl)methanone
• Methanone, [3-(1-azetidinylmethyl)phenyl](2,3-dimethylphenyl)-