CAS 898771-71-6
:Methanone, [3-(1-azetidinylmethyl)phenyl](2,4-dimethylphenyl)-
Description:
Methanone, [3-(1-azetidinylmethyl)phenyl](2,4-dimethylphenyl)-, identified by its CAS number 898771-71-6, is an organic compound characterized by its complex structure featuring a methanone functional group. This compound includes a phenyl ring substituted with a 1-azetidinylmethyl group, indicating the presence of a four-membered nitrogen-containing heterocycle, which contributes to its unique chemical properties. The presence of two methyl groups on the phenyl ring enhances its hydrophobic characteristics and may influence its reactivity and interaction with biological systems. Methanone derivatives often exhibit diverse biological activities, making them of interest in medicinal chemistry. The specific arrangement of substituents in this compound can affect its steric and electronic properties, potentially impacting its efficacy in various applications. As with many organic compounds, the stability, solubility, and reactivity of this methanone derivative can be influenced by environmental factors such as temperature and pH. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C19H21NO
InChI:InChI=1S/C19H21NO/c1-14-7-8-18(15(2)11-14)19(21)17-6-3-5-16(12-17)13-20-9-4-10-20/h3,5-8,11-12H,4,9-10,13H2,1-2H3
InChI key:InChIKey=QKDYKYFOTOPKDX-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=C(C)C=C1)C2=CC(CN3CCC3)=CC=C2
Synonyms:- Methanone, [3-(1-azetidinylmethyl)phenyl](2,4-dimethylphenyl)-
- [3-(1-Azetidinylmethyl)phenyl](2,4-dimethylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.