CAS 898771-73-8

Methanone, [3-(1-azetidinylmethyl)phenyl](2,5-dimethylphenyl)-

Description:

Methanone, [3-(1-azetidinylmethyl)phenyl](2,5-dimethylphenyl)-, also known by its CAS number 898771-73-8, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with an azetidine moiety. This compound features a phenyl group that is further substituted with a 2,5-dimethyl group, contributing to its hydrophobic characteristics. The presence of the azetidine ring introduces a cyclic amine structure, which can influence the compound's reactivity and potential biological activity. Methanones are generally known for their role in various chemical reactions, including nucleophilic attacks and as intermediates in organic synthesis. The specific arrangement of substituents in this compound may also affect its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in various fields.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-14-7-8-15(2)18(11-14)19(21)17-6-3-5-16(12-17)13-20-9-4-10-20/h3,5-8,11-12H,4,9-10,13H2,1-2H3

InChI key: InChIKey=AYAXWFWVXVLOMQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC(C)=C1)C2=CC(CN3CCC3)=CC=C2

Synonyms:

• [3-(1-Azetidinylmethyl)phenyl](2,5-dimethylphenyl)methanone
• Methanone, [3-(1-azetidinylmethyl)phenyl](2,5-dimethylphenyl)-