CAS 898771-74-9

Ethyl δ-oxo-3-thiophenepentanoate

Description:

Ethyl δ-oxo-3-thiophenepentanoate, with the CAS number 898771-74-9, is an organic compound characterized by its ester functional group and a thiophene ring. This compound features a pentanoate chain, which contributes to its aliphatic nature, while the presence of the δ-oxo group indicates a ketone functionality adjacent to the ester. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, imparts unique electronic properties and potential reactivity to the molecule. Ethyl δ-oxo-3-thiophenepentanoate may exhibit moderate solubility in organic solvents and could participate in various chemical reactions, such as nucleophilic additions or condensation reactions, due to the presence of both the carbonyl and ester groups. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. As with many organic compounds, its specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₁H₁₄O₃S

InChI: InChI=1S/C11H14O3S/c1-2-14-11(13)5-3-4-10(12)9-6-7-15-8-9/h6-8H,2-5H2,1H3

InChI key: InChIKey=CWNISAMAQXESEE-UHFFFAOYSA-N

SMILES: C(CCCC(OCC)=O)(=O)C=1C=CSC1

Synonyms:

• Ethyl δ-oxo-3-thiophenepentanoate
• 3-Thiophenepentanoic acid, δ-oxo-, ethyl ester