CAS 898771-75-0

Methanone, [3-(1-azetidinylmethyl)phenyl](2,6-dimethylphenyl)-

Description:

Methanone, [3-(1-azetidinylmethyl)phenyl](2,6-dimethylphenyl)-, also known by its CAS number 898771-75-0, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with an azetidine moiety. This compound features a 1-azetidinylmethyl group attached to a phenyl ring, which contributes to its potential biological activity. The presence of the 2,6-dimethylphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. Methanones are generally known for their reactivity, particularly in nucleophilic addition reactions, and can serve as intermediates in organic synthesis. The specific arrangement of substituents in this compound may also impart unique pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential applications.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-14-6-3-7-15(2)18(14)19(21)17-9-4-8-16(12-17)13-20-10-5-11-20/h3-4,6-9,12H,5,10-11,13H2,1-2H3

InChI key: InChIKey=YNVCCUHENJHDHP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC=C1C)C2=CC(CN3CCC3)=CC=C2

Synonyms:

• [3-(1-Azetidinylmethyl)phenyl](2,6-dimethylphenyl)methanone
• Methanone, [3-(1-azetidinylmethyl)phenyl](2,6-dimethylphenyl)-