CAS 898771-83-0
:[3-(azetidin-1-ylmethyl)phenyl]-(4-chloro-3-fluoro-phenyl)methanone
Description:
The chemical substance known as [3-(azetidin-1-ylmethyl)phenyl]-(4-chloro-3-fluoro-phenyl)methanone, with the CAS number 898771-83-0, is a synthetic organic compound characterized by its complex structure that includes both azetidine and phenyl moieties. This compound features a ketone functional group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of halogen substituents, specifically chlorine and fluorine, on the phenyl rings can influence its biological activity, lipophilicity, and overall pharmacokinetic properties. The azetidine ring adds to the molecular complexity and may enhance interactions with biological targets. Such compounds are often investigated for their potential therapeutic effects, particularly in the fields of oncology and neurology, due to their ability to modulate biological pathways. The specific characteristics, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which the compound is studied.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-15-6-5-14(10-16(15)19)17(21)13-4-1-3-12(9-13)11-20-7-2-8-20/h1,3-6,9-10H,2,7-8,11H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(c(c1)F)Cl)CN1CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.