CAS 898771-84-1: 1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-butanone

Description: 1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-butanone, with the CAS number 898771-84-1, is an organic compound characterized by its unique structural features, which include a butanone moiety and a dioxolane ring fused to a thienyl group. This compound typically exhibits properties associated with both ketones and heterocycles, such as moderate polarity and potential reactivity due to the presence of the carbonyl group. The dioxolane ring contributes to its stability and may influence its solubility in various solvents. Additionally, the thienyl group can impart aromatic characteristics, affecting the compound's electronic properties and reactivity. This compound may be of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals or as a building block in complex organic molecules. Its specific physical and chemical properties, such as boiling point, melting point, and reactivity, would require empirical measurement or detailed computational analysis for precise characterization.

Formula: C₁₁H₁₄O₃S

InChI: InChI=1S/C11H14O3S/c1-2-3-8(12)9-4-5-10(15-9)11-13-6-7-14-11/h4-5,11H,2-3,6-7H2,1H3

InChI key: InChIKey=RBWKNKSXJTYANB-UHFFFAOYSA-N

SMILES: O=C(C=1SC(=CC1)C2OCCO2)CCC

Synonyms:

• 1-Butanone, 1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-
• 1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-butanone

5-(1,3-Dioxolan-2-yl)-2-thienyl propyl ketone

CAS: 898771-84-1

• Purity: 97.0%
• Molecular weight: 226.2899932861328

5-(1,3-Dioxolan-2-yl)-2-thienyl propyl ketone

CAS: 898771-84-1

Versatile small molecule scaffold

• Formula: C₁₁H₁₄O₃S
• Purity: Min. 95%
• Molecular weight: 226.29 g/mol