CAS 898771-85-2
:[3-(azetidin-1-ylmethyl)phenyl]-(3-chloro-4-fluoro-phenyl)methanone
Description:
The chemical substance known as [3-(azetidin-1-ylmethyl)phenyl]-(3-chloro-4-fluoro-phenyl)methanone, with the CAS number 898771-85-2, is a synthetic organic compound characterized by its complex structure, which includes an azetidine ring and multiple aromatic systems. This compound features a ketone functional group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of halogen substituents, specifically chlorine and fluorine, on the phenyl rings can influence the compound's electronic properties, solubility, and biological activity. The azetidine moiety may impart unique steric and electronic characteristics, making it of interest in drug design and development. Additionally, the compound's molecular interactions, stability, and potential pharmacological effects would be influenced by its structural features, making it a candidate for further investigation in various chemical and biological contexts. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in research and development.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-15-10-14(5-6-16(15)19)17(21)13-4-1-3-12(9-13)11-20-7-2-8-20/h1,3-6,9-10H,2,7-8,11H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(c(c1)Cl)F)CN1CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.