CAS 898771-90-9
:1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-heptanone
Description:
1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-heptanone, with the CAS number 898771-90-9, is an organic compound characterized by its unique structure that includes a dioxolane ring and a thienyl group. This compound features a heptanone backbone, which contributes to its ketone functional group, making it a potential candidate for various chemical reactions and applications. The presence of the dioxolane ring suggests that it may exhibit properties such as increased stability and solubility in polar solvents. Additionally, the thienyl moiety can impart interesting electronic properties, potentially influencing its reactivity and interactions with other molecules. The compound's molecular structure may allow it to participate in diverse chemical processes, including synthesis in organic chemistry and applications in materials science or pharmaceuticals. However, specific physical properties such as boiling point, melting point, and solubility would need to be determined experimentally or sourced from reliable databases for a comprehensive understanding of its behavior in various environments.
Formula:C14H20O3S
InChI:InChI=1S/C14H20O3S/c1-2-3-4-5-6-11(15)12-7-8-13(18-12)14-16-9-10-17-14/h7-8,14H,2-6,9-10H2,1H3
InChI key:InChIKey=BEUKMUFHIJVHMX-UHFFFAOYSA-N
SMILES:C(CCCCCC)(=O)C=1SC(=CC1)C2OCCO2
Synonyms:- 1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-heptanone
- 1-Heptanone, 1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.