CAS 898771-91-0

[3-(azetidin-1-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [3-(azetidin-1-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone, with the CAS number 898771-91-0, is a synthetic organic compound characterized by its complex structure, which includes an azetidine ring and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the trifluoromethyl group often enhances lipophilicity and can influence biological activity, making it of interest in medicinal chemistry. The azetidine moiety may impart unique steric and electronic properties, potentially affecting the compound's interaction with biological targets. As with many synthetic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions under which it is studied. Overall, this compound may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological activity and potential uses.

Formula: C₁₈H₁₆F₃NO

InChI: InChI=1/C18H16F3NO/c19-18(20,21)16-8-2-1-7-15(16)17(23)14-6-3-5-13(11-14)12-22-9-4-10-22/h1-3,5-8,11H,4,9-10,12H2

SMILES: c1ccc(c(c1)C(=O)c1cccc(c1)CN1CCC1)C(F)(F)F