CymitQuimica logo

CAS 898771-93-2

:

[3-(azetidin-1-ylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as [3-(azetidin-1-ylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone, with the CAS number 898771-93-2, is a synthetic organic compound characterized by its complex structure that includes both an azetidine ring and a trifluoromethyl group. The azetidine moiety contributes to its potential biological activity, while the trifluoromethyl group enhances lipophilicity and may influence the compound's pharmacokinetic properties. This compound is likely to exhibit unique reactivity due to the presence of the carbonyl functional group (ketone), which can participate in various chemical reactions, including nucleophilic attacks. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the azetidine and phenyl groups can lead to diverse biological activities. Additionally, the presence of fluorine atoms often correlates with increased metabolic stability and bioactivity. Overall, this compound represents a class of molecules that may be of interest for further research in drug discovery and development.
Formula:C18H16F3NO
InChI:InChI=1/C18H16F3NO/c19-18(20,21)16-7-2-6-15(11-16)17(23)14-5-1-4-13(10-14)12-22-8-3-9-22/h1-2,4-7,10-11H,3,8-9,12H2
SMILES:c1cc(cc(c1)C(=O)c1cccc(c1)C(F)(F)F)CN1CCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.