CymitQuimica logo

CAS 898771-95-4

:

[3-(azetidin-1-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as [3-(azetidin-1-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 898771-95-4, is a synthetic organic compound characterized by its complex structure, which includes an azetidine ring and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The azetidine moiety may impart unique steric and electronic properties, which can affect interactions with biological targets. As a ketone, it features a carbonyl group that can participate in various chemical reactions, including nucleophilic additions. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through empirical studies.
Formula:C18H16F3NO
InChI:InChI=1/C18H16F3NO/c19-18(20,21)16-7-5-14(6-8-16)17(23)15-4-1-3-13(11-15)12-22-9-2-10-22/h1,3-8,11H,2,9-10,12H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(cc1)C(F)(F)F)CN1CCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.