CAS 898771-96-5
:1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-decanone
Description:
1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-decanone, with the CAS number 898771-96-5, is a synthetic organic compound characterized by its unique structural features. It contains a dioxolane ring, which contributes to its stability and reactivity, and a thienyl group, indicating the presence of a sulfur atom in a five-membered aromatic ring. The decanone moiety suggests that it has a long hydrocarbon chain, which can influence its solubility and lipophilicity. This compound may exhibit interesting biological activities due to its complex structure, making it a candidate for various applications in pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Additionally, the presence of both polar and non-polar regions in its structure may allow it to interact with a variety of biological targets, potentially leading to diverse pharmacological effects. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C17H26O3S
InChI:InChI=1/C17H26O3S/c1-2-3-4-5-6-7-8-9-14(18)15-10-11-16(21-15)17-19-12-13-20-17/h10-11,17H,2-9,12-13H2,1H3
InChI key:InChIKey=SLJNWSGCGOBYIX-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)(=O)C=1SC(=CC1)C2OCCO2
Synonyms:- 1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1-decanone
- 1-Decanone, 1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.