CAS 898771-99-8

[3-(azetidin-1-ylmethyl)phenyl]-(2-chloro-4-fluoro-phenyl)methanone

Description:

The chemical substance known as [3-(azetidin-1-ylmethyl)phenyl]-(2-chloro-4-fluoro-phenyl)methanone, with the CAS number 898771-99-8, is characterized by its complex molecular structure, which includes an azetidine ring and multiple aromatic components. This compound features a phenyl group substituted with a methanone functional group, indicating the presence of a carbonyl group (C=O) linked to a phenyl ring. The azetidine moiety contributes to its potential biological activity, as azetidines are often found in various pharmacologically active compounds. The presence of chlorine and fluorine substituents on the phenyl ring suggests that this compound may exhibit unique electronic properties and enhanced lipophilicity, which can influence its reactivity and interaction with biological targets. Additionally, the specific arrangement of these functional groups may affect the compound's solubility, stability, and overall pharmacokinetic profile. Overall, this substance may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₇H₁₅ClFNO

InChI: InChI=1/C17H15ClFNO/c18-16-10-14(19)5-6-15(16)17(21)13-4-1-3-12(9-13)11-20-7-2-8-20/h1,3-6,9-10H,2,7-8,11H2

Synonyms:

• 3'-AZETIDINOMETHYL-2-CHLORO-4-FLUOROBENZOPHENONE
• Methanone, [3-(1-azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)-