CymitQuimica logo

CAS 898772-01-5

:

[3-(azetidin-1-ylmethyl)phenyl]-(3-chloro-5-fluoro-phenyl)methanone

Description:
The chemical substance known as [3-(azetidin-1-ylmethyl)phenyl]-(3-chloro-5-fluoro-phenyl)methanone, with the CAS number 898772-01-5, is characterized by its complex molecular structure, which includes an azetidine ring and multiple aromatic components. This compound features a ketone functional group, indicated by the presence of the methanone moiety, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of halogen substituents, specifically chlorine and fluorine, suggests that it may exhibit unique electronic properties and biological activity, making it of interest in drug development. The azetidine ring can influence the compound's pharmacokinetics and binding interactions with biological targets. Overall, this substance is likely to be studied for its potential therapeutic effects, particularly in the context of developing new pharmaceuticals, and may exhibit specific characteristics such as solubility, stability, and reactivity that are important for its application in various chemical and biological systems.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-15-8-14(9-16(19)10-15)17(21)13-4-1-3-12(7-13)11-20-5-2-6-20/h1,3-4,7-10H,2,5-6,11H2
SMILES:c1cc(cc(c1)C(=O)c1cc(cc(c1)F)Cl)CN1CCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.