CAS 898772-03-7
:Methanone, [3-(1-azetidinylmethyl)phenyl](4-chloro-2-fluorophenyl)-
Description:
Methanone, [3-(1-azetidinylmethyl)phenyl](4-chloro-2-fluorophenyl)-, is a chemical compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with both a chloro and a fluoro group. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, which can influence its biological activity and reactivity. This compound is likely to exhibit specific pharmacological properties due to its unique arrangement of functional groups, making it of interest in medicinal chemistry. The chloro and fluoro substituents can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interaction with biological targets. Additionally, the compound's molecular weight, solubility, and stability are influenced by these substituents. As with many synthetic organic compounds, safety and handling precautions are essential, as the biological effects and toxicity profiles can vary significantly based on structural characteristics. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C17H15ClFNO
InChI:InChI=1S/C17H15ClFNO/c18-14-5-6-15(16(19)10-14)17(21)13-4-1-3-12(9-13)11-20-7-2-8-20/h1,3-6,9-10H,2,7-8,11H2
InChI key:InChIKey=KOBORHGWJRAWJO-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=C(Cl)C=C1)C2=CC(CN3CCC3)=CC=C2
Synonyms:- Methanone, [3-(1-azetidinylmethyl)phenyl](4-chloro-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.