CAS 898772-06-0

Methanone, [3-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-

Description:

Methanone, [3-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-, also known by its CAS number 898772-06-0, is a chemical compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with dichlorine atoms. The presence of the azetidine moiety suggests that it may exhibit unique steric and electronic properties, potentially influencing its reactivity and interactions with biological systems. This compound is likely to be a solid at room temperature, given its structural characteristics, and may have specific solubility properties in various organic solvents. Its potential applications could span across medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the azetidine ring, which is often associated with bioactive compounds. However, detailed studies on its toxicity, stability, and specific reactivity would be necessary to fully understand its chemical behavior and potential uses. As with many synthetic compounds, safety precautions should be observed when handling this substance in a laboratory setting.

Formula: C₁₇H₁₅Cl₂NO

InChI: InChI=1/C17H15Cl2NO/c18-15-7-2-6-14(16(15)19)17(21)13-5-1-4-12(10-13)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2

InChI key: InChIKey=ZCUDPXBMRLGOCW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=C(Cl)C(Cl)=CC=C3

Synonyms:

• Methanone, [3-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-