CAS 898772-08-2

Ethyl 5-(1,3-dioxolan-2-yl)-2-thiophenecarboxylate

Description:

Ethyl 5-(1,3-dioxolan-2-yl)-2-thiophenecarboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring and a dioxolane moiety. This compound typically exhibits properties associated with both the thiophene and ester functional groups, such as moderate solubility in organic solvents and potential reactivity in various chemical reactions. The presence of the dioxolane ring may impart stability and influence its reactivity, making it a candidate for applications in organic synthesis and materials science. Ethyl 5-(1,3-dioxolan-2-yl)-2-thiophenecarboxylate may also display interesting biological activities, which can be explored for pharmaceutical applications. Its molecular structure suggests potential for interactions with biological systems, although specific biological activity would require empirical investigation. Overall, this compound represents a versatile building block in organic chemistry, with potential implications in various fields, including medicinal chemistry and materials development.

Formula: C₁₀H₁₂O₄S

InChI: InChI=1S/C10H12O4S/c1-2-12-9(11)7-3-4-8(15-7)10-13-5-6-14-10/h3-4,10H,2,5-6H2,1H3

InChI key: InChIKey=FZZQFYUGWXVEBZ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(=CC1)C2OCCO2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-(1,3-dioxolan-2-yl)-, ethyl ester
• Ethyl 5-(1,3-dioxolan-2-yl)-2-thiophenecarboxylate

Ethyl 5-(1,3-Dioxolan-2-yl)-2-thiophenecarboxylate

CAS: 898772-08-2

Formula: C₁₀H₁₂O₄S

Purity: 97.0%

Molecular weight: 228.26

Ref: 10-F202383