CAS 898772-11-7

propyl 5-(1,3-dioxolan-2-yl)thiophene-2-carboxylate

Description:

Propyl 5-(1,3-dioxolan-2-yl)thiophene-2-carboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring, a dioxolane moiety, and an ester functional group. The presence of the thiophene ring imparts aromatic properties, contributing to its potential applications in organic electronics and materials science. The dioxolane ring enhances the compound's stability and solubility, making it suitable for various chemical reactions and applications. As an ester, it may exhibit typical reactivity associated with carboxylate groups, such as hydrolysis and transesterification. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential biological activity, which may be explored in pharmaceutical research. Additionally, the compound's properties, such as boiling point, melting point, and solubility, would be influenced by the presence of the propyl group and the overall molecular interactions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₁H₁₄O₄S

InChI: InChI=1/C11H14O4S/c1-2-5-13-10(12)8-3-4-9(16-8)11-14-6-7-15-11/h3-4,11H,2,5-7H2,1H3

SMILES: CCCOC(=O)c1ccc(C2OCCO2)s1