CAS 898772-14-0

Butyl 5-(1,3-dioxolan-2-yl)-2-thiophenecarboxylate

Description:

Butyl 5-(1,3-dioxolan-2-yl)-2-thiophenecarboxylate is an organic compound characterized by its unique structure, which includes a butyl group, a dioxolane ring, and a thiophene carboxylate moiety. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the dioxolane ring may impart some degree of stability and influence its reactivity, while the thiophene component can contribute to electronic properties, potentially making it useful in applications such as organic electronics or as a building block in synthetic chemistry. The compound may also exhibit biological activity, depending on its specific interactions with biological systems. Its synthesis and handling require standard safety precautions typical for organic compounds, including proper storage and disposal methods. Overall, Butyl 5-(1,3-dioxolan-2-yl)-2-thiophenecarboxylate represents a versatile structure with potential applications in various fields of chemistry and materials science.

Formula: C₁₂H₁₆O₄S

InChI: InChI=1S/C12H16O4S/c1-2-3-6-14-11(13)9-4-5-10(17-9)12-15-7-8-16-12/h4-5,12H,2-3,6-8H2,1H3

InChI key: InChIKey=JCHFEPFEKYVYNG-UHFFFAOYSA-N

SMILES: C(OCCCC)(=O)C=1SC(=CC1)C2OCCO2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-(1,3-dioxolan-2-yl)-, butyl ester
• Butyl 5-(1,3-dioxolan-2-yl)-2-thiophenecarboxylate

Butyl 5-(1,3-Dioxolan-2-yl)-2-thiophenecarboxylate

CAS: 898772-14-0

Formula: C₁₂H₁₆O₄S

Purity: 97.0%

Molecular weight: 256.32

Ref: 10-F202385