CAS 898772-21-9
:[3-(azetidin-1-ylmethyl)phenyl]-(2,4-difluorophenyl)methanone
Description:
The chemical substance known as [3-(azetidin-1-ylmethyl)phenyl]-(2,4-difluorophenyl)methanone, with the CAS number 898772-21-9, is a synthetic organic compound characterized by its complex structure, which includes an azetidine ring and a ketone functional group. This compound features a phenyl group substituted with a difluoromethyl moiety, enhancing its potential reactivity and biological activity. The presence of the azetidine ring suggests potential applications in medicinal chemistry, as such structures are often associated with various pharmacological properties. The difluorophenyl group may contribute to lipophilicity, influencing the compound's solubility and permeability in biological systems. Additionally, the compound's unique arrangement of functional groups may allow for specific interactions with biological targets, making it a candidate for further investigation in drug development. Overall, the characteristics of this compound suggest it may have relevance in fields such as pharmaceuticals, agrochemicals, or materials science, warranting further study to elucidate its properties and potential applications.
Formula:C17H15F2NO
InChI:InChI=1/C17H15F2NO/c18-14-5-6-15(16(19)10-14)17(21)13-4-1-3-12(9-13)11-20-7-2-8-20/h1,3-6,9-10H,2,7-8,11H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(cc1F)F)CN1CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.