CAS 898772-27-5

Methanone, [3-(1-azetidinylmethyl)phenyl](3,5-difluorophenyl)-

Description:

Methanone, [3-(1-azetidinylmethyl)phenyl](3,5-difluorophenyl)-, also known by its CAS number 898772-27-5, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with difluorine atoms. The presence of the azetidine moiety introduces a cyclic amine structure, which can influence the compound's biological activity and chemical reactivity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in hydrogen bonding, which can affect its solubility in various solvents. The difluorophenyl group may enhance lipophilicity and influence the compound's interaction with biological targets. Due to its structural complexity, it may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological activities, toxicity, and stability would require further investigation through experimental studies. Overall, this compound represents a class of organic molecules that could be of interest in various chemical and pharmaceutical research contexts.

Formula: C₁₇H₁₅F₂NO

InChI: InChI=1S/C17H15F2NO/c18-15-8-14(9-16(19)10-15)17(21)13-4-1-3-12(7-13)11-20-5-2-6-20/h1,3-4,7-10H,2,5-6,11H2

InChI key: InChIKey=MUNRIUVVYCTSMA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=CC(F)=CC(F)=C3

Synonyms:

• [3-(1-Azetidinylmethyl)phenyl](3,5-difluorophenyl)methanone
• Methanone, [3-(1-azetidinylmethyl)phenyl](3,5-difluorophenyl)-