CymitQuimica logo

CAS 898772-30-0

:

Methanone, [3-(1-azetidinylmethyl)phenyl](3,4,5-trifluorophenyl)-

Description:
Methanone, [3-(1-azetidinylmethyl)phenyl](3,4,5-trifluorophenyl)-, also known by its CAS number 898772-30-0, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with trifluoromethyl groups. The presence of the azetidine moiety introduces a cyclic amine structure, which can influence the compound's biological activity and reactivity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The trifluoromethyl groups enhance the lipophilicity and stability of the molecule, potentially affecting its pharmacokinetic properties. Additionally, the presence of multiple functional groups suggests that it may interact with biological targets, making it of interest in medicinal chemistry. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of drug development and synthetic chemistry.
Formula:C17H14F3NO
InChI:InChI=1S/C17H14F3NO/c18-14-8-13(9-15(19)16(14)20)17(22)12-4-1-3-11(7-12)10-21-5-2-6-21/h1,3-4,7-9H,2,5-6,10H2
InChI key:InChIKey=PFQRRJVVCYEYAM-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C(F)=C1)C2=CC(CN3CCC3)=CC=C2
Synonyms:
  • [3-(1-Azetidinylmethyl)phenyl](3,4,5-trifluorophenyl)methanone
  • Methanone, [3-(1-azetidinylmethyl)phenyl](3,4,5-trifluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.