CAS 898772-33-3

[3-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone

Description:

[3-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone, with the CAS number 898772-33-3, is a chemical compound that features a cyclopropylmethanone moiety linked to a phenyl group substituted with an azetidinylmethyl group. This compound is characterized by its unique structural features, which include a cyclopropane ring, a ketone functional group, and a nitrogen-containing azetidine ring. The presence of these functional groups suggests potential reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The azetidine ring may contribute to the compound's ability to interact with biological targets, while the cyclopropyl group can influence its pharmacokinetic properties. Additionally, the compound's molecular structure may exhibit specific stereochemical configurations that could affect its biological activity and interactions. Overall, [3-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₄H₁₇NO

InChI: InChI=1S/C14H17NO/c16-14(12-5-6-12)13-4-1-3-11(9-13)10-15-7-2-8-15/h1,3-4,9,12H,2,5-8,10H2

InChI key: InChIKey=HEHDAWGKVFXWRE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCC2)=CC=C1)C3CC3

Synonyms:

• [3-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone
• Methanone, [3-(1-azetidinylmethyl)phenyl]cyclopropyl-