CAS 898772-41-3

3-Chloro-1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-1-propanone

Description:

3-Chloro-1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-1-propanone is a synthetic organic compound characterized by its unique structural features, which include a chloro substituent, a dioxolane ring, and a thienyl group. The presence of the chloro group suggests that it may exhibit reactivity typical of halogenated compounds, potentially participating in nucleophilic substitution reactions. The dioxolane moiety contributes to the compound's stability and may influence its solubility and polarity, while the thienyl group can impart aromatic characteristics and may affect the compound's electronic properties. This compound is likely to be of interest in medicinal chemistry and material science due to its potential biological activity and utility in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many synthetic compounds, safety and handling precautions should be observed, given the presence of reactive functional groups.

Formula: C₁₀H₁₁ClO₃S

InChI: InChI=1S/C10H11ClO3S/c11-4-3-7(12)8-1-2-9(15-8)10-13-5-6-14-10/h1-2,10H,3-6H2

InChI key: InChIKey=FJQNDTNNSJKEJF-UHFFFAOYSA-N

SMILES: C(CCCl)(=O)C=1SC(=CC1)C2OCCO2

Synonyms:

• 1-Propanone, 3-chloro-1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-
• 3-Chloro-1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-1-propanone

2-Chloroethyl 5-(1,3-dioxolan-2-yl)-2-thienyl ketone

CAS: 898772-41-3

Formula: C₁₀H₁₁ClO₃S

Purity: 97.0%

Molecular weight: 246.71

Ref: 10-F202390