CAS 898772-50-4
:cyclopropyl-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone
Description:
Cyclopropyl-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, identified by its CAS number 898772-50-4, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity. The compound also features a thienyl group, derived from thiophene, which contributes to its aromatic properties and potential electronic characteristics. The presence of a 1,3-dioxolane ring adds to its complexity, providing a cyclic ether structure that can influence solubility and reactivity. This compound may exhibit interesting biological activities due to its diverse functional groups, making it a candidate for research in medicinal chemistry. Its synthesis and reactivity can be influenced by the steric and electronic effects of the cyclopropyl and thienyl moieties, which may affect its interactions in various chemical environments. Overall, cyclopropyl-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone represents a fascinating example of a multifunctional organic molecule with potential applications in various fields.
Formula:C11H12O3S
InChI:InChI=1/C11H12O3S/c12-10(7-1-2-7)8-3-4-9(15-8)11-13-5-6-14-11/h3-4,7,11H,1-2,5-6H2
SMILES:C1CC1C(=O)c1ccc(C2OCCO2)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.