CAS 898772-52-6
:cyclobutyl-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone
Description:
Cyclobutyl-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone is a synthetic organic compound characterized by its unique structural features, which include a cyclobutyl group, a dioxolane ring, and a thienyl moiety. The presence of the cyclobutyl group contributes to its rigidity and potential steric effects, while the dioxolane ring introduces oxygen atoms that can participate in hydrogen bonding and influence solubility. The thienyl component, derived from thiophene, adds aromatic character and may enhance the compound's electronic properties. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic and hydrophilic groups. Its potential applications could span various fields, including pharmaceuticals and materials science, where such structural motifs are often explored for their biological activity or as intermediates in chemical synthesis. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as temperature and pH.
Formula:C12H14O3S
InChI:InChI=1/C12H14O3S/c13-11(8-2-1-3-8)9-4-5-10(16-9)12-14-6-7-15-12/h4-5,8,12H,1-3,6-7H2
SMILES:C1CC(C1)C(=O)c1ccc(C2OCCO2)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.