CAS 898772-64-0
:1-[5-(1,3-dioxolan-2-yl)-2-thienyl]pentane-1,4-dione
Description:
1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]pentane-1,4-dione is an organic compound characterized by its unique structure, which includes a pentane backbone with a dione functional group at one end and a thienyl group substituted with a dioxolane ring. This compound typically exhibits properties associated with diketones, such as being a potential precursor in organic synthesis and exhibiting reactivity towards nucleophiles due to the electrophilic nature of the carbonyl groups. The presence of the dioxolane ring contributes to its stability and solubility in various organic solvents. Additionally, the thienyl moiety may impart specific electronic properties, making it of interest in materials science and medicinal chemistry. The compound's molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where the combination of heterocycles can enhance biological activity. As with many organic compounds, its behavior in reactions, stability under different conditions, and interactions with other substances would be influenced by its functional groups and overall molecular geometry.
Formula:C12H14O4S
InChI:InChI=1/C12H14O4S/c1-8(13)2-3-9(14)10-4-5-11(17-10)12-15-6-7-16-12/h4-5,12H,2-3,6-7H2,1H3
SMILES:CC(=O)CCC(=O)c1ccc(C2OCCO2)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.