CAS 898772-66-2

1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1,5-hexanedione

Description:

1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1,5-hexanedione, identified by its CAS number 898772-66-2, is an organic compound characterized by its unique structural features, which include a hexanedione backbone and a dioxolane ring fused with a thienyl group. This compound typically exhibits properties associated with both dicarbonyl compounds and heterocyclic systems, which may influence its reactivity and potential applications in organic synthesis or materials science. The presence of the dioxolane moiety suggests potential for solubility in polar solvents, while the thienyl group may impart electronic properties beneficial for applications in organic electronics or as a building block in pharmaceuticals. Additionally, the compound's functional groups may allow for various chemical transformations, making it a versatile intermediate in synthetic chemistry. Its stability, reactivity, and specific applications would depend on the surrounding conditions and the presence of other functional groups in a given reaction context.

Formula: C₁₃H₁₆O₄S

InChI: InChI=1/C13H16O4S/c1-9(14)3-2-4-10(15)11-5-6-12(18-11)13-16-7-8-17-13/h5-6,13H,2-4,7-8H2,1H3

InChI key: InChIKey=CXRDHTFBBCXYTM-UHFFFAOYSA-N

SMILES: C(CCCC(C)=O)(=O)C=1SC(=CC1)C2OCCO2

Synonyms:

• 1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-1,5-hexanedione
• 1,5-Hexanedione, 1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-

5-(1,3-dioxolan-2-yl)-2-thienyl 4-oxopentyl ketone

CAS: 898772-66-2

Formula: C₁₃H₁₆O₄S

Purity: 97.0%

Molecular weight: 268.33

Ref: 10-F202399