CymitQuimica logo

CAS 898772-80-0

:

1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-2-methyl-propan-1-one

Description:
1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-2-methyl-propan-1-one, with the CAS number 898772-80-0, is an organic compound characterized by its unique structural features, including a dioxolane ring and a thienyl group. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature and having a distinct odor. The presence of the dioxolane moiety suggests potential solubility in polar solvents, while the thienyl group may impart aromatic characteristics and influence reactivity. Its molecular structure indicates that it could participate in various chemical reactions, including nucleophilic additions and substitutions, due to the electrophilic nature of the carbonyl group. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.
Formula:C11H14O3S
InChI:InChI=1/C11H14O3S/c1-7(2)10(12)8-3-4-9(15-8)11-13-5-6-14-11/h3-4,7,11H,5-6H2,1-2H3
SMILES:CC(C)C(=O)c1ccc(C2OCCO2)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.