CAS 898772-94-6
:1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-4-methyl-1-pentanone
Description:
1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-4-methyl-1-pentanone, with the CAS number 898772-94-6, is an organic compound characterized by its unique structural features, including a dioxolane ring and a thienyl group. This compound typically exhibits properties associated with ketones, such as being a polar solvent and having a relatively high boiling point due to the presence of multiple functional groups. The dioxolane moiety contributes to its stability and potential reactivity, while the thienyl group may impart specific electronic properties, influencing its behavior in chemical reactions. Additionally, the presence of the methyl group on the pentanone backbone can affect its steric hindrance and solubility in various solvents. This compound may find applications in organic synthesis, pharmaceuticals, or as a flavoring agent, depending on its reactivity and functional characteristics. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.
Formula:C13H18O3S
InChI:InChI=1S/C13H18O3S/c1-9(2)3-4-10(14)11-5-6-12(17-11)13-15-7-8-16-13/h5-6,9,13H,3-4,7-8H2,1-2H3
InChI key:InChIKey=MTAIXHHKQXJCFY-UHFFFAOYSA-N
SMILES:C(CCC(C)C)(=O)C=1SC(=CC1)C2OCCO2
Synonyms:- 1-Pentanone, 1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-4-methyl-
- 1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-4-methyl-1-pentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.