CAS 898772-96-8

1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-2-ethyl-1-butanone

Description:

1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-2-ethyl-1-butanone, with the CAS number 898772-96-8, is an organic compound characterized by its unique structural features, including a dioxolane ring and a thienyl group. This compound typically exhibits properties associated with both ketones and heterocycles, which may influence its reactivity and stability. The presence of the dioxolane moiety suggests potential for solubility in polar solvents, while the thienyl group may impart aromatic characteristics and contribute to the compound's electronic properties. As a ketone, it may participate in nucleophilic addition reactions and exhibit typical ketone reactivity. The ethyl group enhances its hydrophobic character, potentially affecting its interactions in biological systems or materials. Overall, this compound's unique structure may lead to interesting applications in fields such as organic synthesis, pharmaceuticals, or materials science, although specific applications would depend on further research into its properties and behavior in various environments.

Formula: C₁₃H₁₈O₃S

InChI: InChI=1S/C13H18O3S/c1-3-9(4-2)12(14)10-5-6-11(17-10)13-15-7-8-16-13/h5-6,9,13H,3-4,7-8H2,1-2H3

InChI key: InChIKey=WKESBQUUOORKMR-UHFFFAOYSA-N

SMILES: C(C(CC)CC)(=O)C=1SC(=CC1)C2OCCO2

Synonyms:

• 1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-2-ethyl-1-butanone
• 1-Butanone, 1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-2-ethyl-

5-(1,3-Dioxolan-2-yl)-2-thienyl 1-ethylpropyl ketone

CAS: 898772-96-8

Formula: C₁₃H₁₈O₃S

Purity: 97.0%

Molecular weight: 254.34

Ref: 10-F202412