CAS 898772-98-0

1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-2-ethyl-hexan-1-one

Description:

1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-2-ethyl-hexan-1-one is an organic compound characterized by its unique structure, which includes a dioxolane ring and a thiophene moiety. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the dioxolane ring suggests that it may exhibit properties such as solubility in polar solvents and potential for ring-opening reactions under certain conditions. The thiophene component can impart electronic properties, making it useful in materials science, particularly in organic electronics and photonic applications. Additionally, the ethyl and hexanone substituents enhance its hydrophobic characteristics, which may influence its behavior in biological systems or its utility as a solvent or reagent. Overall, this compound's structural features suggest versatility in chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. However, specific safety and handling guidelines should be followed due to the presence of reactive functional groups.

Formula: C₁₅H₂₂O₃S

InChI: InChI=1/C15H22O3S/c1-3-5-6-11(4-2)14(16)12-7-8-13(19-12)15-17-9-10-18-15/h7-8,11,15H,3-6,9-10H2,1-2H3

SMILES: CCCCC(CC)C(=O)c1ccc(C2OCCO2)s1